C26H25N3O9 — CID 90749184
2-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]furan-3-carboxamide (PubChem CID 90749184) has the molecular formula C26H25N3O9 and a molecular weight of 523.50 g/mol. Its IUPAC name is 2-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]furan-3-carboxamide.
| Compound Name | 2-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 90749184 |
| Molecular Formula | C26H25N3O9 |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 2-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]furan-3-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(O)ccc(-c5occc5C(N)=O)c4C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C26H25N3O9/c1-29(2)18-13-8-9-7-12-10(21-11(24(27)35)5-6-38-21)3-4-14(30)16(12)19(31)15(9)22(33)26(13,37)23(34)17(20(18)32)25(28)36/h3-6,9,13,15,17-18,30,37H,7-8H2,1-2H3,(H2,27,35)(H2,28,36)/t9-,13-,15?,17?,18-,26-/m1/s1 |
| InChIKey | ZCLKVZQABSTGNB-LORGPRFLSA-N |
| XLogP | -0.77 |
| TPSA | 211.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|