C32H36N2O7 — CID 91351921
(4aR,5aS,12aR)-7-[4-(cyclopentylmethyl)cyclopenta-1,3-dien-1-yl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91351921) has the molecular formula C32H36N2O7 and a molecular weight of 560.65 g/mol. Its IUPAC name is (4aR,5aS,12aR)-7-[4-(cyclopentylmethyl)cyclopenta-1,3-dien-1-yl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5aS,12aR)-7-[4-(cyclopentylmethyl)cyclopenta-1,3-dien-1-yl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91351921 |
| Molecular Formula | C32H36N2O7 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | (4aR,5aS,12aR)-7-[4-(cyclopentylmethyl)cyclopenta-1,3-dien-1-yl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(O)ccc(C5=CC=C(CC6CCCC6)C5)c4C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C32H36N2O7/c1-34(2)26-21-14-18-13-20-19(17-8-7-16(12-17)11-15-5-3-4-6-15)9-10-22(35)24(20)27(36)23(18)29(38)32(21,41)30(39)25(28(26)37)31(33)40/h7-10,15,18,21,23,25-26,35,41H,3-6,11-14H2,1-2H3,(H2,33,40)/t18-,21-,23?,25?,26?,32-/m1/s1 |
| InChIKey | NMBPZNXFTQTWFU-JJEWGWNYSA-N |
| XLogP | 2.16 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|