C30H30N2O7 — CID 91003441
(4S,4aS,5aR,12aS)-7-(2,3-dihydro-1H-inden-5-yl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91003441) has the molecular formula C30H30N2O7 and a molecular weight of 530.58 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-7-(2,3-dihydro-1H-inden-5-yl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-7-(2,3-dihydro-1H-inden-5-yl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91003441 |
| Molecular Formula | C30H30N2O7 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | (4S,4aS,5aR,12aS)-7-(2,3-dihydro-1H-inden-5-yl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)ccc(-c5ccc6c(c5)CCC6)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C30H30N2O7/c1-32(2)24-19-12-16-11-18-17(15-7-6-13-4-3-5-14(13)10-15)8-9-20(33)22(18)25(34)21(16)27(36)30(19,39)28(37)23(26(24)35)29(31)38/h6-10,16,19,21,23-24,33,39H,3-5,11-12H2,1-2H3,(H2,31,38)/t16-,19-,21?,23?,24-,30-/m0/s1 |
| InChIKey | NEPCIOBDPBHTRH-CWLLSPDVSA-N |
| XLogP | 1.02 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|