C37H38N2O9 — CID 91093069
ethyl 2-[[4-[(6aS,10S,10aS,11aR)-8-carbamoyl-4,6a-dihydroxy-5,6,7,9-tetraoxo-10-propan-2-yl-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]naphthalen-1-yl]methylamino]acetate (PubChem CID 91093069) has the molecular formula C37H38N2O9 and a molecular weight of 654.72 g/mol. Its IUPAC name is ethyl 2-[[4-[(6aS,10S,10aS,11aR)-8-carbamoyl-4,6a-dihydroxy-5,6,7,9-tetraoxo-10-propan-2-yl-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]naphthalen-1-yl]methylamino]acetate.
| Compound Name | ethyl 2-[[4-[(6aS,10S,10aS,11aR)-8-carbamoyl-4,6a-dihydroxy-5,6,7,9-tetraoxo-10-propan-2-yl-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]naphthalen-1-yl]methylamino]acetate |
|---|---|
| PubChem CID | 91093069 |
| Molecular Formula | C37H38N2O9 |
| Molecular Weight | 654.72 g/mol |
| Exact Mass | 654.26 |
| IUPAC Name | ethyl 2-[[4-[(6aS,10S,10aS,11aR)-8-carbamoyl-4,6a-dihydroxy-5,6,7,9-tetraoxo-10-propan-2-yl-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]naphthalen-1-yl]methylamino]acetate |
| SMILES | CCOC(=O)CNCc1ccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4[C@H](C(C)C)C(=O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2C3=O)c2ccccc12 |
| InChI | InChI=1S/C37H38N2O9/c1-4-48-27(41)16-39-15-18-9-10-22(21-8-6-5-7-20(18)21)23-11-12-26(40)30-24(23)13-19-14-25-28(17(2)3)32(42)31(36(38)46)35(45)37(25,47)34(44)29(19)33(30)43/h5-12,17,19,25,28-29,31,39-40,47H,4,13-16H2,1-3H3,(H2,38,46)/t19-,25-,28-,29?,31?,37-/m0/s1 |
| InChIKey | QXWAXONHNJGQRS-BKFZGWECSA-N |
| XLogP | 2.68 |
| TPSA | 190.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.72 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|