C35H36N2O7 — CID 91105859
(4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-7-[4-(2-methylpropyl)naphthalen-1-yl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91105859) has the molecular formula C35H36N2O7 and a molecular weight of 596.68 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-7-[4-(2-methylpropyl)naphthalen-1-yl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-7-[4-(2-methylpropyl)naphthalen-1-yl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91105859 |
| Molecular Formula | C35H36N2O7 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-7-[4-(2-methylpropyl)naphthalen-1-yl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)Cc1ccc(-c2ccc(O)c3c2C[C@@H]2C[C@@H]4[C@@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@]4(O)C(=O)C2C3=O)c2ccccc12 |
| InChI | InChI=1S/C35H36N2O7/c1-16(2)13-17-9-10-21(20-8-6-5-7-19(17)20)22-11-12-25(38)27-23(22)14-18-15-24-29(37(3)4)31(40)28(34(36)43)33(42)35(24,44)32(41)26(18)30(27)39/h5-12,16,18,24,26,28-29,38,44H,13-15H2,1-4H3,(H2,36,43)/t18-,24-,26?,28?,29-,35-/m1/s1 |
| InChIKey | NLPOTDUEXHUSRL-IEJSAGHGSA-N |
| XLogP | 2.89 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|