C35H40N2O7 — CID 91003348
(4S,4aS,5aR,12aS)-7-[2-ethyl-5-(pyrrolidin-1-ylmethyl)phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91003348) has the molecular formula C35H40N2O7 and a molecular weight of 600.71 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-7-[2-ethyl-5-(pyrrolidin-1-ylmethyl)phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-7-[2-ethyl-5-(pyrrolidin-1-ylmethyl)phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91003348 |
| Molecular Formula | C35H40N2O7 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | (4S,4aS,5aR,12aS)-7-[2-ethyl-5-(pyrrolidin-1-ylmethyl)phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCc1ccc(CN2CCCC2)cc1-c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](C(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C35H40N2O7/c1-4-19-8-7-18(16-37-11-5-6-12-37)13-22(19)21-9-10-25(38)28-23(21)14-20-15-24-26(17(2)3)30(39)29(34(36)43)33(42)35(24,44)32(41)27(20)31(28)40/h7-10,13,17,20,24,26-27,29,38,44H,4-6,11-12,14-16H2,1-3H3,(H2,36,43)/t20-,24-,26-,27?,29?,35-/m0/s1 |
| InChIKey | MHJZRGLPBXGNPM-DCBUQSJASA-N |
| XLogP | 3.03 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|