C36H41NO7 — CID 91004741
(4S,4aS,5aR,12aS)-7-[(4-benzylcyclohexyl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91004741) has the molecular formula C36H41NO7 and a molecular weight of 599.72 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-7-[(4-benzylcyclohexyl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-7-[(4-benzylcyclohexyl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91004741 |
| Molecular Formula | C36H41NO7 |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | (4S,4aS,5aR,12aS)-7-[(4-benzylcyclohexyl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)ccc(CC5CCC(Cc6ccccc6)CC5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C36H41NO7/c1-18(2)27-25-17-23-16-24-22(15-21-10-8-20(9-11-21)14-19-6-4-3-5-7-19)12-13-26(38)29(24)32(40)28(23)33(41)36(25,44)34(42)30(31(27)39)35(37)43/h3-7,12-13,18,20-21,23,25,27-28,30,38,44H,8-11,14-17H2,1-2H3,(H2,37,43)/t20?,21?,23-,25-,27-,28?,30?,36-/m0/s1 |
| InChIKey | ZRWCWGHTQJUWRA-LTTYJHLYSA-N |
| XLogP | 3.80 |
| TPSA | 151.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|