C36H40N2O8 — CID 90926274
(4S,4aS,5aR,12aS)-7-[4-[(2-cyclohexylacetyl)amino]phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90926274) has the molecular formula C36H40N2O8 and a molecular weight of 628.72 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-7-[4-[(2-cyclohexylacetyl)amino]phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-7-[4-[(2-cyclohexylacetyl)amino]phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90926274 |
| Molecular Formula | C36H40N2O8 |
| Molecular Weight | 628.72 g/mol |
| Exact Mass | 628.28 |
| IUPAC Name | (4S,4aS,5aR,12aS)-7-[4-[(2-cyclohexylacetyl)amino]phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)ccc(-c5ccc(NC(=O)CC6CCCCC6)cc5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C36H40N2O8/c1-17(2)27-24-16-20-15-23-22(19-8-10-21(11-9-19)38-26(40)14-18-6-4-3-5-7-18)12-13-25(39)29(23)32(42)28(20)33(43)36(24,46)34(44)30(31(27)41)35(37)45/h8-13,17-18,20,24,27-28,30,39,46H,3-7,14-16H2,1-2H3,(H2,37,45)(H,38,40)/t20-,24-,27-,28?,30?,36-/m0/s1 |
| InChIKey | DRJDKKSZDMDIEA-NGMRYSNWSA-N |
| XLogP | 3.78 |
| TPSA | 180.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.72 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|