C26H25NO8 — CID 90854886
(4S,4aS,5aR,12aS)-7-(furan-3-yl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90854886) has the molecular formula C26H25NO8 and a molecular weight of 479.49 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-7-(furan-3-yl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-7-(furan-3-yl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90854886 |
| Molecular Formula | C26H25NO8 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | (4S,4aS,5aR,12aS)-7-(furan-3-yl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)ccc(-c5ccoc5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H25NO8/c1-10(2)17-15-8-12-7-14-13(11-5-6-35-9-11)3-4-16(28)19(14)22(30)18(12)23(31)26(15,34)24(32)20(21(17)29)25(27)33/h3-6,9-10,12,15,17-18,20,28,34H,7-8H2,1-2H3,(H2,27,33)/t12-,15-,17-,18?,20?,26-/m0/s1 |
| InChIKey | MCUIOMLBFHBVHN-YOMDUMJZSA-N |
| XLogP | 1.47 |
| TPSA | 164.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|