C30H37NO7 — CID 91497178
(4S,4aS,5aR,12aS)-7-(2-cyclohexylethyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91497178) has the molecular formula C30H37NO7 and a molecular weight of 523.63 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-7-(2-cyclohexylethyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-7-(2-cyclohexylethyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91497178 |
| Molecular Formula | C30H37NO7 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | (4S,4aS,5aR,12aS)-7-(2-cyclohexylethyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)ccc(CCC5CCCCC5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C30H37NO7/c1-14(2)21-19-13-17-12-18-16(9-8-15-6-4-3-5-7-15)10-11-20(32)23(18)26(34)22(17)27(35)30(19,38)28(36)24(25(21)33)29(31)37/h10-11,14-15,17,19,21-22,24,32,38H,3-9,12-13H2,1-2H3,(H2,31,37)/t17-,19-,21-,22?,24?,30-/m0/s1 |
| InChIKey | VWCOHCAXHQOFTA-GHBJHJDNSA-N |
| XLogP | 2.72 |
| TPSA | 151.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|