C31H31N3O10 — CID 90952686
[2-[4-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]anilino]-2-oxoethyl] acetate (PubChem CID 90952686) has the molecular formula C31H31N3O10 and a molecular weight of 605.60 g/mol. Its IUPAC name is [2-[4-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]anilino]-2-oxoethyl] acetate.
| Compound Name | [2-[4-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]anilino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 90952686 |
| Molecular Formula | C31H31N3O10 |
| Molecular Weight | 605.60 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | [2-[4-[(6aR,10R,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]anilino]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)Nc1ccc(-c2ccc(O)c3c2C[C@@H]2C[C@@H]4[C@@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@]4(O)C(=O)C2C3=O)cc1 |
| InChI | InChI=1S/C31H31N3O10/c1-13(35)44-12-21(37)33-16-6-4-14(5-7-16)17-8-9-20(36)23-18(17)10-15-11-19-25(34(2)3)27(39)24(30(32)42)29(41)31(19,43)28(40)22(15)26(23)38/h4-9,15,19,22,24-25,36,43H,10-12H2,1-3H3,(H2,32,42)(H,33,37)/t15-,19-,22?,24?,25-,31-/m1/s1 |
| InChIKey | RAALJVDDSFCYPF-FGLHJGKPSA-N |
| XLogP | 0.04 |
| TPSA | 210.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.60 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|