C26H30N2O9 — CID 91397785
butyl (6aS,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracene-1-carboxylate (PubChem CID 91397785) has the molecular formula C26H30N2O9 and a molecular weight of 514.53 g/mol. Its IUPAC name is butyl (6aS,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracene-1-carboxylate.
| Compound Name | butyl (6aS,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracene-1-carboxylate |
|---|---|
| PubChem CID | 91397785 |
| Molecular Formula | C26H30N2O9 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | butyl (6aS,10S,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracene-1-carboxylate |
| SMILES | CCCCOC(=O)c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C26H30N2O9/c1-4-5-8-37-25(35)12-6-7-15(29)17-13(12)9-11-10-14-19(28(2)3)21(31)18(24(27)34)23(33)26(14,36)22(32)16(11)20(17)30/h6-7,11,14,16,18-19,29,36H,4-5,8-10H2,1-3H3,(H2,27,34)/t11-,14-,16?,18?,19-,26-/m0/s1 |
| InChIKey | FMGPHNSOEYAAIV-OORGUOSJSA-N |
| XLogP | -0.18 |
| TPSA | 181.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|