C33H40N4O8 — CID 123230299
4-(dimethylamino)-7-[5-[[2-(dimethylamino)ethylamino]methyl]-2-methoxyphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123230299) has the molecular formula C33H40N4O8 and a molecular weight of 620.70 g/mol. Its IUPAC name is 4-(dimethylamino)-7-[5-[[2-(dimethylamino)ethylamino]methyl]-2-methoxyphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-7-[5-[[2-(dimethylamino)ethylamino]methyl]-2-methoxyphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123230299 |
| Molecular Formula | C33H40N4O8 |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | 4-(dimethylamino)-7-[5-[[2-(dimethylamino)ethylamino]methyl]-2-methoxyphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | COc1ccc(CNCCN(C)C)cc1-c1ccc(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C33H40N4O8/c1-36(2)11-10-35-15-16-6-9-23(45-5)19(12-16)18-7-8-22(38)25-20(18)13-17-14-21-27(37(3)4)29(40)26(32(34)43)31(42)33(21,44)30(41)24(17)28(25)39/h6-9,12,17,21,24,26-27,35,38,44H,10-11,13-15H2,1-5H3,(H2,34,43) |
| InChIKey | BJLXYRKLFQPXIJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 179.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|