C35H43N3O8 — CID 123614619
9-tert-butyl-4-(dimethylamino)-7-[5-[(dimethylamino)methyl]-2-methoxyphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123614619) has the molecular formula C35H43N3O8 and a molecular weight of 633.74 g/mol. Its IUPAC name is 9-tert-butyl-4-(dimethylamino)-7-[5-[(dimethylamino)methyl]-2-methoxyphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 9-tert-butyl-4-(dimethylamino)-7-[5-[(dimethylamino)methyl]-2-methoxyphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123614619 |
| Molecular Formula | C35H43N3O8 |
| Molecular Weight | 633.74 g/mol |
| Exact Mass | 633.31 |
| IUPAC Name | 9-tert-butyl-4-(dimethylamino)-7-[5-[(dimethylamino)methyl]-2-methoxyphenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | COc1ccc(CN(C)C)cc1-c1cc(C(C)(C)C)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C35H43N3O8/c1-34(2,3)22-14-18(19-11-16(15-37(4)5)9-10-23(19)46-8)20-12-17-13-21-27(38(6)7)30(41)26(33(36)44)32(43)35(21,45)31(42)24(17)29(40)25(20)28(22)39/h9-11,14,17,21,24,26-27,39,45H,12-13,15H2,1-8H3,(H2,36,44) |
| InChIKey | IAASZUBPCRENBX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 167.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.74 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|