C28H35N3O8 — CID 90953820
(4S,4aS,5aR,12aS)-7-(1-amino-2-oxopropyl)-9-tert-butyl-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90953820) has the molecular formula C28H35N3O8 and a molecular weight of 541.60 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-7-(1-amino-2-oxopropyl)-9-tert-butyl-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-7-(1-amino-2-oxopropyl)-9-tert-butyl-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90953820 |
| Molecular Formula | C28H35N3O8 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | (4S,4aS,5aR,12aS)-7-(1-amino-2-oxopropyl)-9-tert-butyl-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(=O)C(N)c1cc(C(C)(C)C)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C28H35N3O8/c1-10(32)19(29)13-9-15(27(2,3)4)21(33)17-12(13)7-11-8-14-20(31(5)6)23(35)18(26(30)38)25(37)28(14,39)24(36)16(11)22(17)34/h9,11,14,16,18-20,33,39H,7-8,29H2,1-6H3,(H2,30,38)/t11-,14-,16?,18?,19?,20-,28-/m0/s1 |
| InChIKey | GUPIDTVLTJOZDU-MKNPSDOXSA-N |
| XLogP | -0.25 |
| TPSA | 198.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|