C23H26N5O7+ — CID 123625214
(7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-2-diazonium (PubChem CID 123625214) has the molecular formula C23H26N5O7+ and a molecular weight of 484.49 g/mol. Its IUPAC name is (7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-2-diazonium.
| Compound Name | (7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-2-diazonium |
|---|---|
| PubChem CID | 123625214 |
| Molecular Formula | C23H26N5O7+ |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | (7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-2-diazonium |
| SMILES | CN(C)c1cc([N+]#N)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C23H25N5O7/c1-27(2)12-7-11(26-25)17(29)14-9(12)5-8-6-10-16(28(3)4)19(31)15(22(24)34)21(33)23(10,35)20(32)13(8)18(14)30/h7-8,10,13,15-16,35H,5-6H2,1-4H3,(H2-,24,29,30,34)/p+1/t8?,10?,13?,15?,16-,23-/m0/s1 |
| InChIKey | TVTVOHPSFYZEAS-SQAHIAKDSA-O |
| XLogP | -0.58 |
| TPSA | 186.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|