C31H35N3O7 — CID 91133781
(4S,12aS)-4,7-bis(dimethylamino)-9-(3,5-dimethylphenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91133781) has the molecular formula C31H35N3O7 and a molecular weight of 561.64 g/mol. Its IUPAC name is (4S,12aS)-4,7-bis(dimethylamino)-9-(3,5-dimethylphenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-4,7-bis(dimethylamino)-9-(3,5-dimethylphenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91133781 |
| Molecular Formula | C31H35N3O7 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | (4S,12aS)-4,7-bis(dimethylamino)-9-(3,5-dimethylphenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | Cc1cc(C)cc(-c2cc(N(C)C)c3c(c2O)C(=O)C2C(=O)[C@]4(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)C4CC2C3)c1 |
| InChI | InChI=1S/C31H35N3O7/c1-13-7-14(2)9-15(8-13)17-12-20(33(3)4)18-10-16-11-19-24(34(5)6)27(37)23(30(32)40)29(39)31(19,41)28(38)21(16)26(36)22(18)25(17)35/h7-9,12,16,19,21,23-24,35,41H,10-11H2,1-6H3,(H2,32,40)/t16?,19?,21?,23?,24-,31-/m0/s1 |
| InChIKey | RXIIOGOJHZRHTE-HBEGXWFSSA-N |
| XLogP | 1.22 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|