C23H26N6O7 — CID 136653459
9-azido-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 136653459) has the molecular formula C23H26N6O7 and a molecular weight of 498.50 g/mol. Its IUPAC name is 9-azido-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 9-azido-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 136653459 |
| Molecular Formula | C23H26N6O7 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 9-azido-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(N=[N+]=[N-])c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C23H26N6O7/c1-28(2)12-7-11(26-27-25)17(30)14-9(12)5-8-6-10-16(29(3)4)19(32)15(22(24)35)21(34)23(10,36)20(33)13(8)18(14)31/h7-8,10,13,15-16,30,36H,5-6H2,1-4H3,(H2,24,35) |
| InChIKey | MCDBNCQVJHZGSF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 207.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|