C25H31N3O8 — CID 123977896
4,7-bis(dimethylamino)-10,12a-dihydroxy-9-(methoxymethyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123977896) has the molecular formula C25H31N3O8 and a molecular weight of 501.54 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-10,12a-dihydroxy-9-(methoxymethyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-10,12a-dihydroxy-9-(methoxymethyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123977896 |
| Molecular Formula | C25H31N3O8 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 4,7-bis(dimethylamino)-10,12a-dihydroxy-9-(methoxymethyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | COCc1cc(N(C)C)c2c(c1O)C(=O)C1C(=O)C3(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)C3CC1C2 |
| InChI | InChI=1S/C25H31N3O8/c1-27(2)14-8-11(9-36-5)19(29)16-12(14)6-10-7-13-18(28(3)4)21(31)17(24(26)34)23(33)25(13,35)22(32)15(10)20(16)30/h8,10,13,15,17-18,29,35H,6-7,9H2,1-5H3,(H2,26,34) |
| InChIKey | LRLQSSKGBFCYEI-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 167.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|