C27H37N5O7 — CID 91115461
(4S,4aS,5aR,12aS)-9-[(2-aminopropylamino)methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91115461) has the molecular formula C27H37N5O7 and a molecular weight of 543.62 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-9-[(2-aminopropylamino)methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-9-[(2-aminopropylamino)methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91115461 |
| Molecular Formula | C27H37N5O7 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | (4S,4aS,5aR,12aS)-9-[(2-aminopropylamino)methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(N)CNCc1cc(N(C)C)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C27H37N5O7/c1-11(28)9-30-10-13-8-16(31(2)3)14-6-12-7-15-20(32(4)5)23(35)19(26(29)38)25(37)27(15,39)24(36)17(12)22(34)18(14)21(13)33/h8,11-12,15,17,19-20,30,33,39H,6-7,9-10,28H2,1-5H3,(H2,29,38)/t11?,12-,15-,17?,19?,20-,27-/m0/s1 |
| InChIKey | JJUGLNYGNLXTEJ-NBLYXNQNSA-N |
| XLogP | -1.63 |
| TPSA | 196.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|