C28H35F3N4O7 — CID 90685626
(4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(1,1,1-trifluorobutan-2-ylamino)methyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90685626) has the molecular formula C28H35F3N4O7 and a molecular weight of 596.60 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(1,1,1-trifluorobutan-2-ylamino)methyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(1,1,1-trifluorobutan-2-ylamino)methyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90685626 |
| Molecular Formula | C28H35F3N4O7 |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(1,1,1-trifluorobutan-2-ylamino)methyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCC(NCc1cc(N(C)C)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2)C(F)(F)F |
| InChI | InChI=1S/C28H35F3N4O7/c1-6-16(28(29,30)31)33-10-12-9-15(34(2)3)13-7-11-8-14-20(35(4)5)23(38)19(26(32)41)25(40)27(14,42)24(39)17(11)22(37)18(13)21(12)36/h9,11,14,16-17,19-20,33,36,42H,6-8,10H2,1-5H3,(H2,32,41)/t11-,14-,16?,17?,19?,20-,27-/m0/s1 |
| InChIKey | SDHVCKYDFCRWHC-PNWHQERMSA-N |
| XLogP | 0.36 |
| TPSA | 170.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|