C32H38N4O8 — CID 90788249
(4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[[(4-methoxyphenyl)methylamino]methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90788249) has the molecular formula C32H38N4O8 and a molecular weight of 606.68 g/mol. Its IUPAC name is (4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[[(4-methoxyphenyl)methylamino]methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[[(4-methoxyphenyl)methylamino]methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90788249 |
| Molecular Formula | C32H38N4O8 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | (4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[[(4-methoxyphenyl)methylamino]methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | COc1ccc(CNCc2cc(N(C)C)c3c(c2O)C(=O)C2C(=O)[C@]4(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)[C@@H]4C[C@@H]2C3)cc1 |
| InChI | InChI=1S/C32H38N4O8/c1-35(2)21-12-17(14-34-13-15-6-8-18(44-5)9-7-15)26(37)23-19(21)10-16-11-20-25(36(3)4)28(39)24(31(33)42)30(41)32(20,43)29(40)22(16)27(23)38/h6-9,12,16,20,22,24-25,34,37,43H,10-11,13-14H2,1-5H3,(H2,33,42)/t16-,20-,22?,24?,25?,32-/m0/s1 |
| InChIKey | MKFAFNDJDLLLPL-KQTMWNPUSA-N |
| XLogP | 0.23 |
| TPSA | 179.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|