C29H38N4O7 — CID 91048990
(4aR,5aS,12aR)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(piperidin-1-ylmethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91048990) has the molecular formula C29H38N4O7 and a molecular weight of 554.64 g/mol. Its IUPAC name is (4aR,5aS,12aR)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(piperidin-1-ylmethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5aS,12aR)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(piperidin-1-ylmethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91048990 |
| Molecular Formula | C29H38N4O7 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | (4aR,5aS,12aR)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(piperidin-1-ylmethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CN2CCCCC2)c(O)c2c1C[C@@H]1C[C@@H]3C(N(C)C)C(=O)C(C(N)=O)C(=O)[C@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C29H38N4O7/c1-31(2)18-12-15(13-33-8-6-5-7-9-33)23(34)20-16(18)10-14-11-17-22(32(3)4)25(36)21(28(30)39)27(38)29(17,40)26(37)19(14)24(20)35/h12,14,17,19,21-22,34,40H,5-11,13H2,1-4H3,(H2,30,39)/t14-,17-,19?,21?,22?,29-/m1/s1 |
| InChIKey | KCHFPXXKFVVKCP-WKJLQOOISA-N |
| XLogP | -0.08 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|