C29H32N4O8 — CID 123426860
4,7-bis(dimethylamino)-9-[(3-formylpyrrol-1-yl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123426860) has the molecular formula C29H32N4O8 and a molecular weight of 564.60 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-9-[(3-formylpyrrol-1-yl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-9-[(3-formylpyrrol-1-yl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123426860 |
| Molecular Formula | C29H32N4O8 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 4,7-bis(dimethylamino)-9-[(3-formylpyrrol-1-yl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(Cn2ccc(C=O)c2)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C29H32N4O8/c1-31(2)18-9-15(11-33-6-5-13(10-33)12-34)23(35)20-16(18)7-14-8-17-22(32(3)4)25(37)21(28(30)40)27(39)29(17,41)26(38)19(14)24(20)36/h5-6,9-10,12,14,17,19,21-22,35,41H,7-8,11H2,1-4H3,(H2,30,40) |
| InChIKey | UFVGAPJEBYYTAJ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 180.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|