C28H36N4O7 — CID 90879659
(4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-9-[3-(dimethylamino)prop-1-enyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90879659) has the molecular formula C28H36N4O7 and a molecular weight of 540.62 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-9-[3-(dimethylamino)prop-1-enyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-9-[3-(dimethylamino)prop-1-enyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90879659 |
| Molecular Formula | C28H36N4O7 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-9-[3-(dimethylamino)prop-1-enyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)CC=Cc1cc(N(C)C)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C28H36N4O7/c1-30(2)9-7-8-13-12-17(31(3)4)15-10-14-11-16-21(32(5)6)24(35)20(27(29)38)26(37)28(16,39)25(36)18(14)23(34)19(15)22(13)33/h7-8,12,14,16,18,20-21,33,39H,9-11H2,1-6H3,(H2,29,38)/t14-,16-,18?,20?,21-,28-/m0/s1 |
| InChIKey | FXMUPZPOSPBBAU-UVDWVFJZSA-N |
| XLogP | -0.49 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|