C29H29F2N3O7 — CID 90705340
(4S,4aS,5aR,12aS)-9-(3,4-difluorophenyl)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90705340) has the molecular formula C29H29F2N3O7 and a molecular weight of 569.56 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-9-(3,4-difluorophenyl)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-9-(3,4-difluorophenyl)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90705340 |
| Molecular Formula | C29H29F2N3O7 |
| Molecular Weight | 569.56 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | (4S,4aS,5aR,12aS)-9-(3,4-difluorophenyl)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(-c2ccc(F)c(F)c2)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C29H29F2N3O7/c1-33(2)18-10-13(11-5-6-16(30)17(31)9-11)23(35)20-14(18)7-12-8-15-22(34(3)4)25(37)21(28(32)40)27(39)29(15,41)26(38)19(12)24(20)36/h5-6,9-10,12,15,19,21-22,35,41H,7-8H2,1-4H3,(H2,32,40)/t12-,15-,19?,21?,22-,29-/m0/s1 |
| InChIKey | ZTOSTOWGNZWEOB-ZEPXCECVSA-N |
| XLogP | 0.88 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.56 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|