C31H34FN3O7 — CID 91365041
(4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-9-[2-(4-fluorophenyl)ethyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91365041) has the molecular formula C31H34FN3O7 and a molecular weight of 579.63 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-9-[2-(4-fluorophenyl)ethyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-9-[2-(4-fluorophenyl)ethyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91365041 |
| Molecular Formula | C31H34FN3O7 |
| Molecular Weight | 579.63 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-9-[2-(4-fluorophenyl)ethyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CCc2ccc(F)cc2)c(O)c2c1C[C@@H]1C[C@@H]3[C@@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C31H34FN3O7/c1-34(2)20-13-15(8-5-14-6-9-17(32)10-7-14)25(36)22-18(20)11-16-12-19-24(35(3)4)27(38)23(30(33)41)29(40)31(19,42)28(39)21(16)26(22)37/h6-7,9-10,13,16,19,21,23-24,36,42H,5,8,11-12H2,1-4H3,(H2,33,41)/t16-,19-,21?,23?,24-,31-/m1/s1 |
| InChIKey | IVRHJQDFEPDPNR-SIKORIGLSA-N |
| XLogP | 0.86 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.63 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|