C30H32ClN3O7 — CID 91444355
(4S,4aS,5aR,12aS)-9-(4-chlorophenyl)-4,7-bis(dimethylamino)-10,12a-dihydroxy-N-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91444355) has the molecular formula C30H32ClN3O7 and a molecular weight of 582.05 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-9-(4-chlorophenyl)-4,7-bis(dimethylamino)-10,12a-dihydroxy-N-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-9-(4-chlorophenyl)-4,7-bis(dimethylamino)-10,12a-dihydroxy-N-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91444355 |
| Molecular Formula | C30H32ClN3O7 |
| Molecular Weight | 582.05 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | (4S,4aS,5aR,12aS)-9-(4-chlorophenyl)-4,7-bis(dimethylamino)-10,12a-dihydroxy-N-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CNC(=O)C1C(=O)[C@@H](N(C)C)[C@@H]2C[C@@H]3Cc4c(N(C)C)cc(-c5ccc(Cl)cc5)c(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C30H32ClN3O7/c1-32-29(40)22-26(37)23(34(4)5)18-11-14-10-17-19(33(2)3)12-16(13-6-8-15(31)9-7-13)24(35)21(17)25(36)20(14)27(38)30(18,41)28(22)39/h6-9,12,14,18,20,22-23,35,41H,10-11H2,1-5H3,(H,32,40)/t14-,18-,20?,22?,23-,30-/m0/s1 |
| InChIKey | AYNMOCXXTCWKDS-SRXMHMBUSA-N |
| XLogP | 1.51 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.05 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|