C26H25ClN2O7S — CID 91164647
(4S,4aS,5aR,12aS)-7-(5-chlorothiophen-2-yl)-4-(dimethylamino)-10,12a-dihydroxy-N-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91164647) has the molecular formula C26H25ClN2O7S and a molecular weight of 545.01 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-7-(5-chlorothiophen-2-yl)-4-(dimethylamino)-10,12a-dihydroxy-N-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-7-(5-chlorothiophen-2-yl)-4-(dimethylamino)-10,12a-dihydroxy-N-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91164647 |
| Molecular Formula | C26H25ClN2O7S |
| Molecular Weight | 545.01 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | (4S,4aS,5aR,12aS)-7-(5-chlorothiophen-2-yl)-4-(dimethylamino)-10,12a-dihydroxy-N-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CNC(=O)C1C(=O)[C@@H](N(C)C)[C@@H]2C[C@@H]3Cc4c(-c5ccc(Cl)s5)ccc(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C26H25ClN2O7S/c1-28-25(35)19-22(32)20(29(2)3)13-9-10-8-12-11(15-6-7-16(27)37-15)4-5-14(30)18(12)21(31)17(10)23(33)26(13,36)24(19)34/h4-7,10,13,17,19-20,30,36H,8-9H2,1-3H3,(H,28,35)/t10-,13-,17?,19?,20-,26-/m0/s1 |
| InChIKey | YGOLRTVEHPLRRN-LUHIYKOKSA-N |
| XLogP | 1.51 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.01 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|