C27H35N3O7 — CID 90718479
(4S,4aS,5aR,12aS)-N-tert-butyl-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90718479) has the molecular formula C27H35N3O7 and a molecular weight of 513.59 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-N-tert-butyl-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-N-tert-butyl-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90718479 |
| Molecular Formula | C27H35N3O7 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | (4S,4aS,5aR,12aS)-N-tert-butyl-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(=O)NC(C)(C)C)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C27H35N3O7/c1-26(2,3)28-25(36)19-22(33)20(30(6)7)14-11-12-10-13-15(29(4)5)8-9-16(31)18(13)21(32)17(12)23(34)27(14,37)24(19)35/h8-9,12,14,17,19-20,31,37H,10-11H2,1-7H3,(H,28,36)/t12-,14-,17?,19?,20-,27-/m0/s1 |
| InChIKey | SWFPLTHIDJYUGX-KIROHXLSSA-N |
| XLogP | 0.36 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|