C26H31ClN4O8 — CID 91009590
(4S,4aS,5aR,12aS)-N-[[(2-chloroacetyl)amino]methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91009590) has the molecular formula C26H31ClN4O8 and a molecular weight of 563.01 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-N-[[(2-chloroacetyl)amino]methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-N-[[(2-chloroacetyl)amino]methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91009590 |
| Molecular Formula | C26H31ClN4O8 |
| Molecular Weight | 563.01 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | (4S,4aS,5aR,12aS)-N-[[(2-chloroacetyl)amino]methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(=O)NCNC(=O)CCl)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C26H31ClN4O8/c1-30(2)14-5-6-15(32)18-12(14)7-11-8-13-20(31(3)4)22(35)19(25(38)29-10-28-16(33)9-27)24(37)26(13,39)23(36)17(11)21(18)34/h5-6,11,13,17,19-20,32,39H,7-10H2,1-4H3,(H,28,33)(H,29,38)/t11-,13-,17?,19?,20-,26-/m0/s1 |
| InChIKey | VCPASSCMAGDCOG-JXELXUGVSA-N |
| XLogP | -1.12 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.01 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|