C26H28N2O6S — CID 123905272
4-(dimethylamino)-10,12a-dihydroxy-7-(5-methylthiophen-2-yl)-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 123905272) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is 4-(dimethylamino)-10,12a-dihydroxy-7-(5-methylthiophen-2-yl)-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-10,12a-dihydroxy-7-(5-methylthiophen-2-yl)-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123905272 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 4-(dimethylamino)-10,12a-dihydroxy-7-(5-methylthiophen-2-yl)-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(O)c3c2CC2CC4C(N(C)C)C(=O)C(C(N)=O)CC4(O)C(=O)C2C3=O)s1 |
| InChI | InChI=1S/C26H28N2O6S/c1-11-4-7-18(35-11)13-5-6-17(29)20-14(13)8-12-9-16-21(28(2)3)22(30)15(25(27)33)10-26(16,34)24(32)19(12)23(20)31/h4-7,12,15-16,19,21,29,34H,8-10H2,1-3H3,(H2,27,33) |
| InChIKey | MYDVKUJYEWIXQD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|