C23H26N2O7 — CID 123717561
7-acetyl-4-(dimethylamino)-10,12a-dihydroxy-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 123717561) has the molecular formula C23H26N2O7 and a molecular weight of 442.47 g/mol. Its IUPAC name is 7-acetyl-4-(dimethylamino)-10,12a-dihydroxy-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | 7-acetyl-4-(dimethylamino)-10,12a-dihydroxy-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123717561 |
| Molecular Formula | C23H26N2O7 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 7-acetyl-4-(dimethylamino)-10,12a-dihydroxy-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CC(=O)c1ccc(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)CC3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C23H26N2O7/c1-9(26)11-4-5-15(27)17-12(11)6-10-7-14-18(25(2)3)19(28)13(22(24)31)8-23(14,32)21(30)16(10)20(17)29/h4-5,10,13-14,16,18,27,32H,6-8H2,1-3H3,(H2,24,31) |
| InChIKey | XHOVBRXRLGHWKG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|