C21H21ClN2O10S — CID 90950296
(6aS,7S,10aS)-9-carbamoyl-4-chloro-7-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-2-sulfonic acid (PubChem CID 90950296) has the molecular formula C21H21ClN2O10S and a molecular weight of 528.92 g/mol. Its IUPAC name is (6aS,7S,10aS)-9-carbamoyl-4-chloro-7-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-2-sulfonic acid.
| Compound Name | (6aS,7S,10aS)-9-carbamoyl-4-chloro-7-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-2-sulfonic acid |
|---|---|
| PubChem CID | 90950296 |
| Molecular Formula | C21H21ClN2O10S |
| Molecular Weight | 528.92 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | (6aS,7S,10aS)-9-carbamoyl-4-chloro-7-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracene-2-sulfonic acid |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)c(S(=O)(=O)O)cc(Cl)c4CC3C[C@@H]12 |
| InChI | InChI=1S/C21H21ClN2O10S/c1-24(2)14-8-4-6-3-7-9(22)5-10(35(32,33)34)15(25)12(7)16(26)11(6)18(28)21(8,31)19(29)13(17(14)27)20(23)30/h5-6,8,11,13-14,25,31H,3-4H2,1-2H3,(H2,23,30)(H,32,33,34)/t6?,8-,11?,13?,14-,21-/m0/s1 |
| InChIKey | APCKPHBBEISIEJ-WMIGAHNPSA-N |
| XLogP | -1.23 |
| TPSA | 209.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.92 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|