C26H34N4O7 — CID 57279616
(4S,12aS)-9-amino-4-(dimethylamino)-10,12a-dihydroxy-7-[methyl(2-methylpropyl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 57279616) has the molecular formula C26H34N4O7 and a molecular weight of 514.58 g/mol. Its IUPAC name is (4S,12aS)-9-amino-4-(dimethylamino)-10,12a-dihydroxy-7-[methyl(2-methylpropyl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-9-amino-4-(dimethylamino)-10,12a-dihydroxy-7-[methyl(2-methylpropyl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 57279616 |
| Molecular Formula | C26H34N4O7 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (4S,12aS)-9-amino-4-(dimethylamino)-10,12a-dihydroxy-7-[methyl(2-methylpropyl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)CN(C)c1cc(N)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C26H34N4O7/c1-10(2)9-30(5)15-8-14(27)20(31)17-12(15)6-11-7-13-19(29(3)4)22(33)18(25(28)36)24(35)26(13,37)23(34)16(11)21(17)32/h8,10-11,13,16,18-19,31,37H,6-7,9,27H2,1-5H3,(H2,28,36)/t11?,13?,16?,18?,19-,26-/m0/s1 |
| InChIKey | NCAKVYMOSHESBS-LIOHZBAKSA-N |
| XLogP | -0.46 |
| TPSA | 184.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|