C27H34N4O9 — CID 57175058
(4S,12aS)-4-(dimethylamino)-7-[ethyl(2-methylpropyl)amino]-10,12a-dihydroxy-9-nitro-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 57175058) has the molecular formula C27H34N4O9 and a molecular weight of 558.59 g/mol. Its IUPAC name is (4S,12aS)-4-(dimethylamino)-7-[ethyl(2-methylpropyl)amino]-10,12a-dihydroxy-9-nitro-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-4-(dimethylamino)-7-[ethyl(2-methylpropyl)amino]-10,12a-dihydroxy-9-nitro-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 57175058 |
| Molecular Formula | C27H34N4O9 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | (4S,12aS)-4-(dimethylamino)-7-[ethyl(2-methylpropyl)amino]-10,12a-dihydroxy-9-nitro-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCN(CC(C)C)c1cc([N+](=O)[O-])c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C27H34N4O9/c1-6-30(10-11(2)3)15-9-16(31(39)40)21(32)18-13(15)7-12-8-14-20(29(4)5)23(34)19(26(28)37)25(36)27(14,38)24(35)17(12)22(18)33/h9,11-12,14,17,19-20,32,38H,6-8,10H2,1-5H3,(H2,28,37)/t12?,14?,17?,19?,20-,27-/m0/s1 |
| InChIKey | OGKSEDCNVHIKKK-RIWDQJDQSA-N |
| XLogP | 0.26 |
| TPSA | 201.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|