C29H38N4O9 — CID 57157521
(4S,12aS)-7-[butyl(2-methylpropyl)amino]-4-(dimethylamino)-10,12a-dihydroxy-9-nitro-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 57157521) has the molecular formula C29H38N4O9 and a molecular weight of 586.64 g/mol. Its IUPAC name is (4S,12aS)-7-[butyl(2-methylpropyl)amino]-4-(dimethylamino)-10,12a-dihydroxy-9-nitro-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-7-[butyl(2-methylpropyl)amino]-4-(dimethylamino)-10,12a-dihydroxy-9-nitro-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 57157521 |
| Molecular Formula | C29H38N4O9 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | (4S,12aS)-7-[butyl(2-methylpropyl)amino]-4-(dimethylamino)-10,12a-dihydroxy-9-nitro-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCCCN(CC(C)C)c1cc([N+](=O)[O-])c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C29H38N4O9/c1-6-7-8-32(12-13(2)3)17-11-18(33(41)42)23(34)20-15(17)9-14-10-16-22(31(4)5)25(36)21(28(30)39)27(38)29(16,40)26(37)19(14)24(20)35/h11,13-14,16,19,21-22,34,40H,6-10,12H2,1-5H3,(H2,30,39)/t14?,16?,19?,21?,22-,29-/m0/s1 |
| InChIKey | NXDGLKWBKOPCSO-NPHIZKLWSA-N |
| XLogP | 1.04 |
| TPSA | 201.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|