C29H40N4O7 — CID 56983308
(4S,12aS)-9-amino-7-[butan-2-yl(2-methylpropyl)amino]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 56983308) has the molecular formula C29H40N4O7 and a molecular weight of 556.66 g/mol. Its IUPAC name is (4S,12aS)-9-amino-7-[butan-2-yl(2-methylpropyl)amino]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-9-amino-7-[butan-2-yl(2-methylpropyl)amino]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 56983308 |
| Molecular Formula | C29H40N4O7 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | (4S,12aS)-9-amino-7-[butan-2-yl(2-methylpropyl)amino]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCC(C)N(CC(C)C)c1cc(N)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C29H40N4O7/c1-7-13(4)33(11-12(2)3)18-10-17(30)23(34)20-15(18)8-14-9-16-22(32(5)6)25(36)21(28(31)39)27(38)29(16,40)26(37)19(14)24(20)35/h10,12-14,16,19,21-22,34,40H,7-9,11,30H2,1-6H3,(H2,31,39)/t13?,14?,16?,19?,21?,22-,29-/m0/s1 |
| InChIKey | QRWWVNOERUJGAA-LIDQGHBFSA-N |
| XLogP | 0.71 |
| TPSA | 184.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|