C28H38N6O7 — CID 123878081
(4aR,5aS,12aR)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[[N'-(2-methylpropyl)carbamimidoyl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123878081) has the molecular formula C28H38N6O7 and a molecular weight of 570.65 g/mol. Its IUPAC name is (4aR,5aS,12aR)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[[N'-(2-methylpropyl)carbamimidoyl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5aS,12aR)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[[N'-(2-methylpropyl)carbamimidoyl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123878081 |
| Molecular Formula | C28H38N6O7 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | (4aR,5aS,12aR)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[[N'-(2-methylpropyl)carbamimidoyl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)C/N=C(\N)Nc1cc(N(C)C)c2c(c1O)C(=O)C1C(=O)[C@@]3(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)[C@H]3C[C@H]1C2 |
| InChI | InChI=1S/C28H38N6O7/c1-11(2)10-31-27(30)32-15-9-16(33(3)4)13-7-12-8-14-20(34(5)6)23(37)19(26(29)40)25(39)28(14,41)24(38)17(12)22(36)18(13)21(15)35/h9,11-12,14,17,19-20,35,41H,7-8,10H2,1-6H3,(H2,29,40)(H3,30,31,32)/t12-,14-,17?,19?,20?,28-/m1/s1 |
| InChIKey | HNSSQSTTYDNJOA-ODRVKJLHSA-N |
| XLogP | -0.68 |
| TPSA | 208.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|