C30H38N4O11 — CID 91166739
[(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamoyloxymethyl 2,2-dimethylpropanoate (PubChem CID 91166739) has the molecular formula C30H38N4O11 and a molecular weight of 630.65 g/mol. Its IUPAC name is [(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamoyloxymethyl 2,2-dimethylpropanoate.
| Compound Name | [(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamoyloxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 91166739 |
| Molecular Formula | C30H38N4O11 |
| Molecular Weight | 630.65 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | [(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamoyloxymethyl 2,2-dimethylpropanoate |
| SMILES | CN(C)c1cc(NC(=O)OCOC(=O)C(C)(C)C)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C30H38N4O11/c1-29(2,3)27(41)44-11-45-28(42)32-15-10-16(33(4)5)13-8-12-9-14-20(34(6)7)23(37)19(26(31)40)25(39)30(14,43)24(38)17(12)22(36)18(13)21(15)35/h10,12,14,17,19-20,35,43H,8-9,11H2,1-7H3,(H2,31,40)(H,32,42)/t12-,14-,17?,19?,20-,30-/m0/s1 |
| InChIKey | JHANPFXENUQAAZ-FARTXCABSA-N |
| XLogP | 0.03 |
| TPSA | 222.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.65 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|