C32H34F3N5O8 — CID 123332841
4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[[4-methyl-2-(trifluoromethyl)phenyl]carbamoylamino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123332841) has the molecular formula C32H34F3N5O8 and a molecular weight of 673.65 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[[4-methyl-2-(trifluoromethyl)phenyl]carbamoylamino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[[4-methyl-2-(trifluoromethyl)phenyl]carbamoylamino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123332841 |
| Molecular Formula | C32H34F3N5O8 |
| Molecular Weight | 673.65 g/mol |
| Exact Mass | 673.24 |
| IUPAC Name | 4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[[4-methyl-2-(trifluoromethyl)phenyl]carbamoylamino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)Nc2cc(N(C)C)c3c(c2O)C(=O)C2C(=O)C4(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)C4CC2C3)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H34F3N5O8/c1-12-6-7-17(15(8-12)32(33,34)35)37-30(47)38-18-11-19(39(2)3)14-9-13-10-16-23(40(4)5)26(43)22(29(36)46)28(45)31(16,48)27(44)20(13)25(42)21(14)24(18)41/h6-8,11,13,16,20,22-23,41,48H,9-10H2,1-5H3,(H2,36,46)(H2,37,38,47) |
| InChIKey | BXZQVBVQXLOIPG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 199.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.65 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|