C31H40N4O11 — CID 90735616
[(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamoyloxymethyl 3,3-dimethylbutanoate (PubChem CID 90735616) has the molecular formula C31H40N4O11 and a molecular weight of 644.68 g/mol. Its IUPAC name is [(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamoyloxymethyl 3,3-dimethylbutanoate.
| Compound Name | [(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamoyloxymethyl 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 90735616 |
| Molecular Formula | C31H40N4O11 |
| Molecular Weight | 644.68 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | [(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamoyloxymethyl 3,3-dimethylbutanoate |
| SMILES | CN(C)c1cc(NC(=O)OCOC(=O)CC(C)(C)C)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C31H40N4O11/c1-30(2,3)11-18(36)45-12-46-29(43)33-16-10-17(34(4)5)14-8-13-9-15-22(35(6)7)25(39)21(28(32)42)27(41)31(15,44)26(40)19(13)24(38)20(14)23(16)37/h10,13,15,19,21-22,37,44H,8-9,11-12H2,1-7H3,(H2,32,42)(H,33,43)/t13-,15-,19?,21?,22-,31-/m0/s1 |
| InChIKey | IKYJBWATJJCMCR-DMPHVGHOSA-N |
| XLogP | 0.42 |
| TPSA | 222.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.68 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|