C31H32F3N5O9 — CID 123472393
4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[4-(trifluoromethoxy)phenyl]carbamoylamino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123472393) has the molecular formula C31H32F3N5O9 and a molecular weight of 675.62 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[4-(trifluoromethoxy)phenyl]carbamoylamino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[4-(trifluoromethoxy)phenyl]carbamoylamino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123472393 |
| Molecular Formula | C31H32F3N5O9 |
| Molecular Weight | 675.62 g/mol |
| Exact Mass | 675.22 |
| IUPAC Name | 4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[4-(trifluoromethoxy)phenyl]carbamoylamino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)Nc2ccc(OC(F)(F)F)cc2)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C31H32F3N5O9/c1-38(2)18-11-17(37-29(46)36-13-5-7-14(8-6-13)48-31(32,33)34)23(40)20-15(18)9-12-10-16-22(39(3)4)25(42)21(28(35)45)27(44)30(16,47)26(43)19(12)24(20)41/h5-8,11-12,16,19,21-22,40,47H,9-10H2,1-4H3,(H2,35,45)(H2,36,37,46) |
| InChIKey | GZJJUEUJGSBNIQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 208.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.62 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|