C28H30N4O9 — CID 91367606
N-[(7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]furan-2-carboxamide (PubChem CID 91367606) has the molecular formula C28H30N4O9 and a molecular weight of 566.57 g/mol. Its IUPAC name is N-[(7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]furan-2-carboxamide.
| Compound Name | N-[(7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 91367606 |
| Molecular Formula | C28H30N4O9 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | N-[(7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]furan-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)c2ccco2)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C28H30N4O9/c1-31(2)15-10-14(30-27(39)16-6-5-7-41-16)21(33)18-12(15)8-11-9-13-20(32(3)4)23(35)19(26(29)38)25(37)28(13,40)24(36)17(11)22(18)34/h5-7,10-11,13,17,19-20,33,40H,8-9H2,1-4H3,(H2,29,38)(H,30,39)/t11?,13?,17?,19?,20-,28-/m0/s1 |
| InChIKey | XARACNPMCQXKOV-ZBCBGOBMSA-N |
| XLogP | -0.22 |
| TPSA | 200.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|