C29H32N4O9S — CID 91414820
(4R,4aR,5aS,12aR)-9-(benzenesulfonamido)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91414820) has the molecular formula C29H32N4O9S and a molecular weight of 612.66 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-9-(benzenesulfonamido)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-9-(benzenesulfonamido)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91414820 |
| Molecular Formula | C29H32N4O9S |
| Molecular Weight | 612.66 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | (4R,4aR,5aS,12aR)-9-(benzenesulfonamido)-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NS(=O)(=O)c2ccccc2)c(O)c2c1C[C@@H]1C[C@@H]3[C@@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C29H32N4O9S/c1-32(2)18-12-17(31-43(41,42)14-8-6-5-7-9-14)23(34)20-15(18)10-13-11-16-22(33(3)4)25(36)21(28(30)39)27(38)29(16,40)26(37)19(13)24(20)35/h5-9,12-13,16,19,21-22,31,34,40H,10-11H2,1-4H3,(H2,30,39)/t13-,16-,19?,21?,22-,29-/m1/s1 |
| InChIKey | ORZIFQHOMQKACY-WPYLTYITSA-N |
| XLogP | -0.27 |
| TPSA | 204.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.66 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|