C34H42N4O7 — CID 91014650
(4R,4aR,5aS,12aR)-9-[(2-tert-butylphenyl)methylamino]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91014650) has the molecular formula C34H42N4O7 and a molecular weight of 618.73 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-9-[(2-tert-butylphenyl)methylamino]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-9-[(2-tert-butylphenyl)methylamino]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91014650 |
| Molecular Formula | C34H42N4O7 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | (4R,4aR,5aS,12aR)-9-[(2-tert-butylphenyl)methylamino]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NCc2ccccc2C(C)(C)C)c(O)c2c1C[C@@H]1C[C@@H]3[C@@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C34H42N4O7/c1-33(2,3)19-11-9-8-10-16(19)15-36-21-14-22(37(4)5)18-12-17-13-20-26(38(6)7)29(41)25(32(35)44)31(43)34(20,45)30(42)23(17)28(40)24(18)27(21)39/h8-11,14,17,20,23,25-26,36,39,45H,12-13,15H2,1-7H3,(H2,35,44)/t17-,20-,23?,25?,26-,34-/m1/s1 |
| InChIKey | LLHDXDJKZKHGMS-WJVGHBSISA-N |
| XLogP | 1.84 |
| TPSA | 170.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|