C31H36N4O9 — CID 91135599
(4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[(3-hydroxy-4-methoxyphenyl)methylamino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91135599) has the molecular formula C31H36N4O9 and a molecular weight of 608.65 g/mol. Its IUPAC name is (4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[(3-hydroxy-4-methoxyphenyl)methylamino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[(3-hydroxy-4-methoxyphenyl)methylamino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91135599 |
| Molecular Formula | C31H36N4O9 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | (4aS,5aR,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[(3-hydroxy-4-methoxyphenyl)methylamino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | COc1ccc(CNc2cc(N(C)C)c3c(c2O)C(=O)C2C(=O)[C@]4(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)[C@@H]4C[C@@H]2C3)cc1O |
| InChI | InChI=1S/C31H36N4O9/c1-34(2)18-11-17(33-12-13-6-7-20(44-5)19(36)8-13)25(37)22-15(18)9-14-10-16-24(35(3)4)27(39)23(30(32)42)29(41)31(16,43)28(40)21(14)26(22)38/h6-8,11,14,16,21,23-24,33,36-37,43H,9-10,12H2,1-5H3,(H2,32,42)/t14-,16-,21?,23?,24?,31-/m0/s1 |
| InChIKey | XUDHMSRCJLRTIW-FJRJCACXSA-N |
| XLogP | 0.26 |
| TPSA | 199.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|