C30H32FN5O8 — CID 91574756
(4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-9-[(3-fluorophenyl)carbamoylamino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91574756) has the molecular formula C30H32FN5O8 and a molecular weight of 609.61 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-9-[(3-fluorophenyl)carbamoylamino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-9-[(3-fluorophenyl)carbamoylamino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91574756 |
| Molecular Formula | C30H32FN5O8 |
| Molecular Weight | 609.61 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-9-[(3-fluorophenyl)carbamoylamino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)Nc2cccc(F)c2)c(O)c2c1C[C@@H]1C[C@@H]3[C@@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C30H32FN5O8/c1-35(2)18-11-17(34-29(43)33-14-7-5-6-13(31)10-14)23(37)20-15(18)8-12-9-16-22(36(3)4)25(39)21(28(32)42)27(41)30(16,44)26(40)19(12)24(20)38/h5-7,10-12,16,19,21-22,37,44H,8-9H2,1-4H3,(H2,32,42)(H2,33,34,43)/t12-,16-,19?,21?,22-,30-/m1/s1 |
| InChIKey | NYXOOYDKBZSCOY-BERAGHDCSA-N |
| XLogP | 0.72 |
| TPSA | 199.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.61 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|