C24H27ClN2O8 — CID 91202409
(4R,4aR,5aS,12aR)-7-[(Z)-2-chloro-3-hydroxyprop-1-enyl]-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 91202409) has the molecular formula C24H27ClN2O8 and a molecular weight of 506.94 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-7-[(Z)-2-chloro-3-hydroxyprop-1-enyl]-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-7-[(Z)-2-chloro-3-hydroxyprop-1-enyl]-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91202409 |
| Molecular Formula | C24H27ClN2O8 |
| Molecular Weight | 506.94 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (4R,4aR,5aS,12aR)-7-[(Z)-2-chloro-3-hydroxyprop-1-enyl]-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(O)ccc(/C=C(\Cl)CO)c4C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C24H27ClN2O8/c1-27(2)18-13-7-10-6-12-9(5-11(25)8-28)3-4-14(29)16(12)19(30)15(10)21(32)24(13,35)22(33)17(20(18)31)23(26)34/h3-5,10,13,15,17-18,20,28-29,31,35H,6-8H2,1-2H3,(H2,26,34)/b11-5-/t10-,13-,15?,17?,18-,20?,24-/m1/s1 |
| InChIKey | WDMDTCMWMGFQHU-CULMRKSLSA-N |
| XLogP | -0.77 |
| TPSA | 178.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.94 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|