C27H29N3O7S — CID 91479961
(4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-7-[2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 91479961) has the molecular formula C27H29N3O7S and a molecular weight of 539.61 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-7-[2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-7-[2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91479961 |
| Molecular Formula | C27H29N3O7S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-7-[2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | Cc1ncsc1C=Cc1ccc(O)c2c1C[C@@H]1C[C@@H]3[C@@H](N(C)C)C(O)C(C(N)=O)C(=O)[C@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C27H29N3O7S/c1-11-17(38-10-29-11)7-5-12-4-6-16(31)19-14(12)8-13-9-15-21(30(2)3)23(33)20(26(28)36)25(35)27(15,37)24(34)18(13)22(19)32/h4-7,10,13,15,18,20-21,23,31,33,37H,8-9H2,1-3H3,(H2,28,36)/t13-,15-,18?,20?,21-,23?,27-/m1/s1 |
| InChIKey | MAXRUSQZRNPTGM-DAPHNPRNSA-N |
| XLogP | 0.59 |
| TPSA | 171.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|